O-(2-Aminoethyl)-O'-(2-carboxyethyl)Polyethylene glycol 5, 000 hydrochloride

Name: O-(2-Aminoethyl)-O'-(2-carboxyethyl)Polyethylene glycol 5, 000 hydrochloride
SKU: ACM187848664-4
Rating: 5 (1 reviews)

PRICE INQUIRY

Catalog NumberACM187848664-4

CAS Number187848-66-4

CategoryPolystyrene (PS)

Molecular Formula

NH2CH2CH2O(CH2CH2O)nCH2CH2COOH.HCl

Application

O-(2-Aminoethyl)-O'-(2-carboxyethyl) Polyethylene glycol 5,000 hydrochloride serves as a versatile cross-linking reagent. Its primary purpose is to facilitate various biological and chemical applications, such as the aggregation of vesicle polymersomes and the immobilization of functionalized peroxidase onto permethylated α-cyclodextrin-appended polystyrene giant amphiphiles. Additionally, it acts as a platform for oligonucleotide delivery by employing a PEG prodrug approach. This reagent is also used for folate-receptor-targeted delivery of doxorubicin nano-aggregates, stabilized through a doxorubicin-PEG-folate conjugate, enhancing the efficacy and delivery of therapeutic agents in research and development settings.

Personal Protective Equipment

Eyeshields, gloves, type N95, type P1 (EN143) respirator filter

WGK Germany

If you have any other questions or need other size, please get a quote.